C25H37F9O6 — CID 89468025
4-O-[2-[4,4-dimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxyethyl] 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) butanedioate (PubChem CID 89468025) has the molecular formula C25H37F9O6 and a molecular weight of 604.55 g/mol. Its IUPAC name is 4-O-[2-[4,4-dimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxyethyl] 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) butanedioate.
| Compound Name | 4-O-[2-[4,4-dimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxyethyl] 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) butanedioate |
|---|---|
| PubChem CID | 89468025 |
| Molecular Formula | C25H37F9O6 |
| Molecular Weight | 604.55 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | 4-O-[2-[4,4-dimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxyethyl] 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) butanedioate |
| SMILES | CCC(C)(C)CC(C(=O)OCCOC(=O)CCC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(C)(C)CC |
| InChI | InChI=1S/C25H37F9O6/c1-7-20(3,4)15-16(21(5,6)8-2)19(37)40-14-13-39-18(36)10-9-17(35)38-12-11-22(26,27)23(28,29)24(30,31)25(32,33)34/h16H,7-15H2,1-6H3 |
| InChIKey | PXMGRBURMDNTBZ-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.55 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|