C23H29F17O3 — CID 89025505
[3,4,4,4-tetrafluoro-3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)butyl] 4,4-dimethyl-2-(2-methylbutan-2-yl)hexanoate (PubChem CID 89025505) has the molecular formula C23H29F17O3 and a molecular weight of 676.45 g/mol. Its IUPAC name is [3,4,4,4-tetrafluoro-3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)butyl] 4,4-dimethyl-2-(2-methylbutan-2-yl)hexanoate.
| Compound Name | [3,4,4,4-tetrafluoro-3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)butyl] 4,4-dimethyl-2-(2-methylbutan-2-yl)hexanoate |
|---|---|
| PubChem CID | 89025505 |
| Molecular Formula | C23H29F17O3 |
| Molecular Weight | 676.45 g/mol |
| Exact Mass | 676.18 |
| IUPAC Name | [3,4,4,4-tetrafluoro-3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)butyl] 4,4-dimethyl-2-(2-methylbutan-2-yl)hexanoate |
| SMILES | CCC(C)(C)CC(C(=O)OCCC(F)(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(C)(C)CC |
| InChI | InChI=1S/C23H29F17O3/c1-7-14(3,4)11-12(15(5,6)8-2)13(41)42-10-9-16(24,21(33,34)35)43-23(39,40)20(31,32)18(27,28)17(25,26)19(29,30)22(36,37)38/h12H,7-11H2,1-6H3 |
| InChIKey | LYTWZYMXMYUMNF-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.45 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|