C15H27NO2 — CID 134267923
2-cyanoethyl 2-(2,2-dimethylpropyl)-3,3-dimethylpentanoate (PubChem CID 134267923) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-cyanoethyl 2-(2,2-dimethylpropyl)-3,3-dimethylpentanoate.
| Compound Name | 2-cyanoethyl 2-(2,2-dimethylpropyl)-3,3-dimethylpentanoate |
|---|---|
| PubChem CID | 134267923 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 2-cyanoethyl 2-(2,2-dimethylpropyl)-3,3-dimethylpentanoate |
| SMILES | CCC(C)(C)C(CC(C)(C)C)C(=O)OCCC#N |
| InChI | InChI=1S/C15H27NO2/c1-7-15(5,6)12(11-14(2,3)4)13(17)18-10-8-9-16/h12H,7-8,10-11H2,1-6H3 |
| InChIKey | DUNTUOQALAWTPP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|