C7H5F6NO2 — CID 2748435
2-cyanoethyl 3,3,3-trifluoro-2-(trifluoromethyl)propanoate (PubChem CID 2748435) has the molecular formula C7H5F6NO2 and a molecular weight of 249.11 g/mol. Its IUPAC name is 2-cyanoethyl 3,3,3-trifluoro-2-(trifluoromethyl)propanoate.
| Compound Name | 2-cyanoethyl 3,3,3-trifluoro-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 2748435 |
| Molecular Formula | C7H5F6NO2 |
| Molecular Weight | 249.11 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | 2-cyanoethyl 3,3,3-trifluoro-2-(trifluoromethyl)propanoate |
| SMILES | N#CCCOC(=O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H5F6NO2/c8-6(9,10)4(7(11,12)13)5(15)16-3-1-2-14/h4H,1,3H2 |
| InChIKey | WABLBISFYYMTLZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.11 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|