About azane;2-cyanoethyl hydrogen carbonate
azane;2-cyanoethyl hydrogen carbonate (PubChem CID 174589632) has the molecular formula C4H8N2O3
and a molecular weight of 132.12 g/mol. Its IUPAC name is azane;2-cyanoethyl hydrogen carbonate.
Molecular Properties
| Compound Name | azane;2-cyanoethyl hydrogen carbonate |
| PubChem CID | 174589632 |
| Molecular Formula | C4H8N2O3 |
| Molecular Weight | 132.12 g/mol |
| Exact Mass | 132.05 |
| IUPAC Name | azane;2-cyanoethyl hydrogen carbonate |
| SMILES | N.N#CCCOC(=O)O |
| InChI | InChI=1S/C4H5NO3.H3N/c5-2-1-3-8-4(6)7;/h1,3H2,(H,6,7);1H3 |
| InChIKey | SOBAZUAEBBSTKP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.12 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;2-cyanoethyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-cyanoethyl hydrogen carbonate?
The IUPAC name of azane;2-cyanoethyl hydrogen carbonate (CID 174589632) is azane;2-cyanoethyl hydrogen carbonate.
What is the SMILES notation for azane;2-cyanoethyl hydrogen carbonate?
The canonical SMILES for azane;2-cyanoethyl hydrogen carbonate is N.N#CCCOC(=O)O.
What is the InChIKey of azane;2-cyanoethyl hydrogen carbonate?
The InChIKey is SOBAZUAEBBSTKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO3.H3N/c5-2-1-3-8-4(6)7;/h1,3H2,(H,6,7);1H3.
What are the key properties of azane;2-cyanoethyl hydrogen carbonate?
azane;2-cyanoethyl hydrogen carbonate has a molecular weight of 132.12 g/mol, XLogP of 0.76, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-cyanoethyl hydrogen carbonate is sourced from PubChem (CID 174589632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).