About 4-cyanobutyl hydrogen carbonate;ethylcyclopropane
4-cyanobutyl hydrogen carbonate;ethylcyclopropane (PubChem CID 175185296) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is 4-cyanobutyl hydrogen carbonate;ethylcyclopropane.
Molecular Properties
| Compound Name | 4-cyanobutyl hydrogen carbonate;ethylcyclopropane |
| PubChem CID | 175185296 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 4-cyanobutyl hydrogen carbonate;ethylcyclopropane |
| SMILES | CCC1CC1.N#CCCCCOC(=O)O |
| InChI | InChI=1S/C6H9NO3.C5H10/c7-4-2-1-3-5-10-6(8)9;1-2-5-3-4-5/h1-3,5H2,(H,8,9);5H,2-4H2,1H3 |
| InChIKey | CWCPDUPELDAPKT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-cyanobutyl hydrogen carbonate;ethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyanobutyl hydrogen carbonate;ethylcyclopropane?
The IUPAC name of 4-cyanobutyl hydrogen carbonate;ethylcyclopropane (CID 175185296) is 4-cyanobutyl hydrogen carbonate;ethylcyclopropane.
What is the SMILES notation for 4-cyanobutyl hydrogen carbonate;ethylcyclopropane?
The canonical SMILES for 4-cyanobutyl hydrogen carbonate;ethylcyclopropane is CCC1CC1.N#CCCCCOC(=O)O.
What is the InChIKey of 4-cyanobutyl hydrogen carbonate;ethylcyclopropane?
The InChIKey is CWCPDUPELDAPKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3.C5H10/c7-4-2-1-3-5-10-6(8)9;1-2-5-3-4-5/h1-3,5H2,(H,8,9);5H,2-4H2,1H3.
What are the key properties of 4-cyanobutyl hydrogen carbonate;ethylcyclopropane?
4-cyanobutyl hydrogen carbonate;ethylcyclopropane has a molecular weight of 213.28 g/mol, XLogP of 3.18, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyanobutyl hydrogen carbonate;ethylcyclopropane is sourced from PubChem (CID 175185296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).