About 3-cyanopropyl nonyl carbonate
3-cyanopropyl nonyl carbonate (PubChem CID 155213062) has the molecular formula C14H25NO3
and a molecular weight of 255.36 g/mol. Its IUPAC name is 3-cyanopropyl nonyl carbonate.
Molecular Properties
| Compound Name | 3-cyanopropyl nonyl carbonate |
| PubChem CID | 155213062 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 3-cyanopropyl nonyl carbonate |
| SMILES | CCCCCCCCCOC(=O)OCCCC#N |
| InChI | InChI=1S/C14H25NO3/c1-2-3-4-5-6-7-9-12-17-14(16)18-13-10-8-11-15/h2-10,12-13H2,1H3 |
| InChIKey | LLLCMXHRUBEAOZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-cyanopropyl nonyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyanopropyl nonyl carbonate?
The IUPAC name of 3-cyanopropyl nonyl carbonate (CID 155213062) is 3-cyanopropyl nonyl carbonate.
What is the SMILES notation for 3-cyanopropyl nonyl carbonate?
The canonical SMILES for 3-cyanopropyl nonyl carbonate is CCCCCCCCCOC(=O)OCCCC#N.
What is the InChIKey of 3-cyanopropyl nonyl carbonate?
The InChIKey is LLLCMXHRUBEAOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO3/c1-2-3-4-5-6-7-9-12-17-14(16)18-13-10-8-11-15/h2-10,12-13H2,1H3.
What are the key properties of 3-cyanopropyl nonyl carbonate?
3-cyanopropyl nonyl carbonate has a molecular weight of 255.36 g/mol, XLogP of 4.19, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyanopropyl nonyl carbonate is sourced from PubChem (CID 155213062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).