About 2-cyanoethyl dodecyl carbonate
2-cyanoethyl dodecyl carbonate (PubChem CID 155213216) has the molecular formula C16H29NO3
and a molecular weight of 283.41 g/mol. Its IUPAC name is 2-cyanoethyl dodecyl carbonate.
Molecular Properties
| Compound Name | 2-cyanoethyl dodecyl carbonate |
| PubChem CID | 155213216 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 2-cyanoethyl dodecyl carbonate |
| SMILES | CCCCCCCCCCCCOC(=O)OCCC#N |
| InChI | InChI=1S/C16H29NO3/c1-2-3-4-5-6-7-8-9-10-11-14-19-16(18)20-15-12-13-17/h2-12,14-15H2,1H3 |
| InChIKey | JRNATUHDYKGCQP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoethyl dodecyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoethyl dodecyl carbonate?
The IUPAC name of 2-cyanoethyl dodecyl carbonate (CID 155213216) is 2-cyanoethyl dodecyl carbonate.
What is the SMILES notation for 2-cyanoethyl dodecyl carbonate?
The canonical SMILES for 2-cyanoethyl dodecyl carbonate is CCCCCCCCCCCCOC(=O)OCCC#N.
What is the InChIKey of 2-cyanoethyl dodecyl carbonate?
The InChIKey is JRNATUHDYKGCQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29NO3/c1-2-3-4-5-6-7-8-9-10-11-14-19-16(18)20-15-12-13-17/h2-12,14-15H2,1H3.
What are the key properties of 2-cyanoethyl dodecyl carbonate?
2-cyanoethyl dodecyl carbonate has a molecular weight of 283.41 g/mol, XLogP of 4.97, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoethyl dodecyl carbonate is sourced from PubChem (CID 155213216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).