About 2-cyanoethyl 3-bromo-2-oxopropanoate
2-cyanoethyl 3-bromo-2-oxopropanoate (PubChem CID 86090895) has the molecular formula C6H6BrNO3
and a molecular weight of 220.02 g/mol. Its IUPAC name is 2-cyanoethyl 3-bromo-2-oxopropanoate.
Molecular Properties
| Compound Name | 2-cyanoethyl 3-bromo-2-oxopropanoate |
| PubChem CID | 86090895 |
| Molecular Formula | C6H6BrNO3 |
| Molecular Weight | 220.02 g/mol |
| Exact Mass | 218.95 |
| IUPAC Name | 2-cyanoethyl 3-bromo-2-oxopropanoate |
| SMILES | N#CCCOC(=O)C(=O)CBr |
| InChI | InChI=1S/C6H6BrNO3/c7-4-5(9)6(10)11-3-1-2-8/h1,3-4H2 |
| InChIKey | ISJNZUBLOAVXSH-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.02 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoethyl 3-bromo-2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoethyl 3-bromo-2-oxopropanoate?
The IUPAC name of 2-cyanoethyl 3-bromo-2-oxopropanoate (CID 86090895) is 2-cyanoethyl 3-bromo-2-oxopropanoate.
What is the SMILES notation for 2-cyanoethyl 3-bromo-2-oxopropanoate?
The canonical SMILES for 2-cyanoethyl 3-bromo-2-oxopropanoate is N#CCCOC(=O)C(=O)CBr.
What is the InChIKey of 2-cyanoethyl 3-bromo-2-oxopropanoate?
The InChIKey is ISJNZUBLOAVXSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrNO3/c7-4-5(9)6(10)11-3-1-2-8/h1,3-4H2.
What are the key properties of 2-cyanoethyl 3-bromo-2-oxopropanoate?
2-cyanoethyl 3-bromo-2-oxopropanoate has a molecular weight of 220.02 g/mol, XLogP of 0.41, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoethyl 3-bromo-2-oxopropanoate is sourced from PubChem (CID 86090895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).