C21H29F9O6 — CID 90191139
3-O-[[3,3-dimethyl-2-(2-methylpropyl)pentanoyl]oxymethyl] 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) propanedioate (PubChem CID 90191139) has the molecular formula C21H29F9O6 and a molecular weight of 548.44 g/mol. Its IUPAC name is 3-O-[[3,3-dimethyl-2-(2-methylpropyl)pentanoyl]oxymethyl] 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) propanedioate.
| Compound Name | 3-O-[[3,3-dimethyl-2-(2-methylpropyl)pentanoyl]oxymethyl] 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) propanedioate |
|---|---|
| PubChem CID | 90191139 |
| Molecular Formula | C21H29F9O6 |
| Molecular Weight | 548.44 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | 3-O-[[3,3-dimethyl-2-(2-methylpropyl)pentanoyl]oxymethyl] 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) propanedioate |
| SMILES | CCC(C)(C)C(CC(C)C)C(=O)OCOC(=O)CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H29F9O6/c1-6-17(4,5)13(9-12(2)3)16(33)36-11-35-15(32)10-14(31)34-8-7-18(22,23)19(24,25)20(26,27)21(28,29)30/h12-13H,6-11H2,1-5H3 |
| InChIKey | XSGRJGKBVZXOGR-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.44 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|