C16H23F5O6 — CID 89467628
3-O-[(2-ethyl-3,3-dimethylpentanoyl)oxymethyl] 1-O-(2,2,3,3,3-pentafluoropropyl) propanedioate (PubChem CID 89467628) has the molecular formula C16H23F5O6 and a molecular weight of 406.34 g/mol. Its IUPAC name is 3-O-[(2-ethyl-3,3-dimethylpentanoyl)oxymethyl] 1-O-(2,2,3,3,3-pentafluoropropyl) propanedioate.
| Compound Name | 3-O-[(2-ethyl-3,3-dimethylpentanoyl)oxymethyl] 1-O-(2,2,3,3,3-pentafluoropropyl) propanedioate |
|---|---|
| PubChem CID | 89467628 |
| Molecular Formula | C16H23F5O6 |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 3-O-[(2-ethyl-3,3-dimethylpentanoyl)oxymethyl] 1-O-(2,2,3,3,3-pentafluoropropyl) propanedioate |
| SMILES | CCC(C(=O)OCOC(=O)CC(=O)OCC(F)(F)C(F)(F)F)C(C)(C)CC |
| InChI | InChI=1S/C16H23F5O6/c1-5-10(14(3,4)6-2)13(24)27-9-26-12(23)7-11(22)25-8-15(17,18)16(19,20)21/h10H,5-9H2,1-4H3 |
| InChIKey | LPROGONJACDYIQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|