C10H16F5NO2 — CID 59204036
2,2,3,3,3-pentafluoropropyl 3-(diethylamino)propanoate (PubChem CID 59204036) has the molecular formula C10H16F5NO2 and a molecular weight of 277.23 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl 3-(diethylamino)propanoate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl 3-(diethylamino)propanoate |
|---|---|
| PubChem CID | 59204036 |
| Molecular Formula | C10H16F5NO2 |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 3-(diethylamino)propanoate |
| SMILES | CCN(CC)CCC(=O)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H16F5NO2/c1-3-16(4-2)6-5-8(17)18-7-9(11,12)10(13,14)15/h3-7H2,1-2H3 |
| InChIKey | MBAVEBOCNDJMEO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|