C11H20F3NO3 — CID 62027910
methyl 3-[ethyl-[3-(2,2,2-trifluoroethoxy)propyl]amino]propanoate (PubChem CID 62027910) has the molecular formula C11H20F3NO3 and a molecular weight of 271.28 g/mol. Its IUPAC name is methyl 3-[ethyl-[3-(2,2,2-trifluoroethoxy)propyl]amino]propanoate.
| Compound Name | methyl 3-[ethyl-[3-(2,2,2-trifluoroethoxy)propyl]amino]propanoate |
|---|---|
| PubChem CID | 62027910 |
| Molecular Formula | C11H20F3NO3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | methyl 3-[ethyl-[3-(2,2,2-trifluoroethoxy)propyl]amino]propanoate |
| SMILES | CCN(CCCOCC(F)(F)F)CCC(=O)OC |
| InChI | InChI=1S/C11H20F3NO3/c1-3-15(7-5-10(16)17-2)6-4-8-18-9-11(12,13)14/h3-9H2,1-2H3 |
| InChIKey | IGVJTEIKDYZPEW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|