C10H21NO3 — CID 65180873
3-[3-ethoxypropyl(ethyl)amino]propanoic acid (PubChem CID 65180873) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is 3-[3-ethoxypropyl(ethyl)amino]propanoic acid.
| Compound Name | 3-[3-ethoxypropyl(ethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 65180873 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 3-[3-ethoxypropyl(ethyl)amino]propanoic acid |
| SMILES | CCOCCCN(CC)CCC(=O)O |
| InChI | InChI=1S/C10H21NO3/c1-3-11(8-6-10(12)13)7-5-9-14-4-2/h3-9H2,1-2H3,(H,12,13) |
| InChIKey | DKIDAJQYRAFFQR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|