C12H25NO3 — CID 82328964
3-[3-ethoxypropyl(2-methylpropyl)amino]propanoic acid (PubChem CID 82328964) has the molecular formula C12H25NO3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 3-[3-ethoxypropyl(2-methylpropyl)amino]propanoic acid.
| Compound Name | 3-[3-ethoxypropyl(2-methylpropyl)amino]propanoic acid |
|---|---|
| PubChem CID | 82328964 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 3-[3-ethoxypropyl(2-methylpropyl)amino]propanoic acid |
| SMILES | CCOCCCN(CCC(=O)O)CC(C)C |
| InChI | InChI=1S/C12H25NO3/c1-4-16-9-5-7-13(10-11(2)3)8-6-12(14)15/h11H,4-10H2,1-3H3,(H,14,15) |
| InChIKey | QXKDDRCZSOTKTJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|