C20H24F17NO2 — CID 59013000
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl 3-(dibutylamino)propanoate (PubChem CID 59013000) has the molecular formula C20H24F17NO2 and a molecular weight of 633.38 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl 3-(dibutylamino)propanoate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl 3-(dibutylamino)propanoate |
|---|---|
| PubChem CID | 59013000 |
| Molecular Formula | C20H24F17NO2 |
| Molecular Weight | 633.38 g/mol |
| Exact Mass | 633.15 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl 3-(dibutylamino)propanoate |
| SMILES | CCCCN(CCCC)CCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H24F17NO2/c1-3-5-8-38(9-6-4-2)10-7-12(39)40-11-13(21,22)14(23,24)15(25,26)16(27,28)17(29,30)18(31,32)19(33,34)20(35,36)37/h3-11H2,1-2H3 |
| InChIKey | KQQKYNMBMXGMNL-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.38 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|