C22H34F6O6 — CID 89468015
1-O-[2-[4,4-dimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxyethyl] 4-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) butanedioate (PubChem CID 89468015) has the molecular formula C22H34F6O6 and a molecular weight of 508.50 g/mol. Its IUPAC name is 1-O-[2-[4,4-dimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxyethyl] 4-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) butanedioate.
| Compound Name | 1-O-[2-[4,4-dimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxyethyl] 4-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) butanedioate |
|---|---|
| PubChem CID | 89468015 |
| Molecular Formula | C22H34F6O6 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | 1-O-[2-[4,4-dimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxyethyl] 4-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) butanedioate |
| SMILES | CCC(C)(C)CC(C(=O)OCCOC(=O)CCC(=O)OC(C(F)(F)F)C(F)(F)F)C(C)(C)CC |
| InChI | InChI=1S/C22H34F6O6/c1-7-19(3,4)13-14(20(5,6)8-2)17(31)33-12-11-32-15(29)9-10-16(30)34-18(21(23,24)25)22(26,27)28/h14,18H,7-13H2,1-6H3 |
| InChIKey | NUBIYCBXNKYODH-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|