C15H20F6O6 — CID 89030920
1-O-(4,4-dimethylhexanoyloxymethyl) 3-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) propanedioate (PubChem CID 89030920) has the molecular formula C15H20F6O6 and a molecular weight of 410.31 g/mol. Its IUPAC name is 1-O-(4,4-dimethylhexanoyloxymethyl) 3-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) propanedioate.
| Compound Name | 1-O-(4,4-dimethylhexanoyloxymethyl) 3-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) propanedioate |
|---|---|
| PubChem CID | 89030920 |
| Molecular Formula | C15H20F6O6 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 1-O-(4,4-dimethylhexanoyloxymethyl) 3-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) propanedioate |
| SMILES | CCC(C)(C)CCC(=O)OCOC(=O)CC(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H20F6O6/c1-4-13(2,3)6-5-9(22)25-8-26-10(23)7-11(24)27-12(14(16,17)18)15(19,20)21/h12H,4-8H2,1-3H3 |
| InChIKey | BNAIMLGMTOLSFX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|