C13H25NO2 — CID 167255818
4,4-dimethyl-2-(2-methylbutan-2-yl)-N-oxohexanamide (PubChem CID 167255818) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 4,4-dimethyl-2-(2-methylbutan-2-yl)-N-oxohexanamide.
| Compound Name | 4,4-dimethyl-2-(2-methylbutan-2-yl)-N-oxohexanamide |
|---|---|
| PubChem CID | 167255818 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 4,4-dimethyl-2-(2-methylbutan-2-yl)-N-oxohexanamide |
| SMILES | CCC(C)(C)CC(C(=O)N=O)C(C)(C)CC |
| InChI | InChI=1S/C13H25NO2/c1-7-12(3,4)9-10(11(15)14-16)13(5,6)8-2/h10H,7-9H2,1-6H3 |
| InChIKey | RGUATCBNMVAAST-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |