About (2R)-2-hydroxy-3,3-dimethylpentanamide
(2R)-2-hydroxy-3,3-dimethylpentanamide (PubChem CID 126746768) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is (2R)-2-hydroxy-3,3-dimethylpentanamide.
Molecular Properties
| Compound Name | (2R)-2-hydroxy-3,3-dimethylpentanamide |
| PubChem CID | 126746768 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | (2R)-2-hydroxy-3,3-dimethylpentanamide |
| SMILES | CCC(C)(C)[C@@H](O)C(N)=O |
| InChI | InChI=1S/C7H15NO2/c1-4-7(2,3)5(9)6(8)10/h5,9H,4H2,1-3H3,(H2,8,10)/t5-/m0/s1 |
| InChIKey | BMAVAJGWCLKGLJ-YFKPBYRVSA-N |
| XLogP | 0.27 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-hydroxy-3,3-dimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-hydroxy-3,3-dimethylpentanamide?
The IUPAC name of (2R)-2-hydroxy-3,3-dimethylpentanamide (CID 126746768) is (2R)-2-hydroxy-3,3-dimethylpentanamide.
What is the SMILES notation for (2R)-2-hydroxy-3,3-dimethylpentanamide?
The canonical SMILES for (2R)-2-hydroxy-3,3-dimethylpentanamide is CCC(C)(C)[C@@H](O)C(N)=O.
What is the InChIKey of (2R)-2-hydroxy-3,3-dimethylpentanamide?
The InChIKey is BMAVAJGWCLKGLJ-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H15NO2/c1-4-7(2,3)5(9)6(8)10/h5,9H,4H2,1-3H3,(H2,8,10)/t5-/m0/s1.
What are the key properties of (2R)-2-hydroxy-3,3-dimethylpentanamide?
(2R)-2-hydroxy-3,3-dimethylpentanamide has a molecular weight of 145.20 g/mol, XLogP of 0.27, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-hydroxy-3,3-dimethylpentanamide is sourced from PubChem (CID 126746768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).