C9H17Cl4NOS — CID 88763879
carbamothioic S-acid;1,1,1,3-tetrachloro-4,4-dimethylhexane (PubChem CID 88763879) has the molecular formula C9H17Cl4NOS and a molecular weight of 329.12 g/mol. Its IUPAC name is carbamothioic S-acid;1,1,1,3-tetrachloro-4,4-dimethylhexane.
| Compound Name | carbamothioic S-acid;1,1,1,3-tetrachloro-4,4-dimethylhexane |
|---|---|
| PubChem CID | 88763879 |
| Molecular Formula | C9H17Cl4NOS |
| Molecular Weight | 329.12 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | carbamothioic S-acid;1,1,1,3-tetrachloro-4,4-dimethylhexane |
| SMILES | CCC(C)(C)C(Cl)CC(Cl)(Cl)Cl.NC(=O)S |
| InChI | InChI=1S/C8H14Cl4.CH3NOS/c1-4-7(2,3)6(9)5-8(10,11)12;2-1(3)4/h6H,4-5H2,1-3H3;(H3,2,3,4) |
| InChIKey | NHQMPHJVYDHINW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.12 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|