C10H14Cl4O4 — CID 88763948
6,8,8,8-tetrachloro-5-(hydroxymethyl)-5-methyl-3-oxooctanoic acid (PubChem CID 88763948) has the molecular formula C10H14Cl4O4 and a molecular weight of 340.03 g/mol. Its IUPAC name is 6,8,8,8-tetrachloro-5-(hydroxymethyl)-5-methyl-3-oxooctanoic acid.
| Compound Name | 6,8,8,8-tetrachloro-5-(hydroxymethyl)-5-methyl-3-oxooctanoic acid |
|---|---|
| PubChem CID | 88763948 |
| Molecular Formula | C10H14Cl4O4 |
| Molecular Weight | 340.03 g/mol |
| Exact Mass | 337.96 |
| IUPAC Name | 6,8,8,8-tetrachloro-5-(hydroxymethyl)-5-methyl-3-oxooctanoic acid |
| SMILES | CC(CO)(CC(=O)CC(=O)O)C(Cl)CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H14Cl4O4/c1-9(5-15,3-6(16)2-8(17)18)7(11)4-10(12,13)14/h7,15H,2-5H2,1H3,(H,17,18) |
| InChIKey | AFCBIVVOLXWIES-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.03 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|