C4H3Cl4F3 — CID 58915594
2,4,4,4-tetrachloro-1,1,1-trifluorobutane (PubChem CID 58915594) has the molecular formula C4H3Cl4F3 and a molecular weight of 249.87 g/mol. Its IUPAC name is 2,4,4,4-tetrachloro-1,1,1-trifluorobutane.
| Compound Name | 2,4,4,4-tetrachloro-1,1,1-trifluorobutane |
|---|---|
| PubChem CID | 58915594 |
| Molecular Formula | C4H3Cl4F3 |
| Molecular Weight | 249.87 g/mol |
| Exact Mass | 247.89 |
| IUPAC Name | 2,4,4,4-tetrachloro-1,1,1-trifluorobutane |
| SMILES | FC(F)(F)C(Cl)CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C4H3Cl4F3/c5-2(4(9,10)11)1-3(6,7)8/h2H,1H2 |
| InChIKey | MYZZPNNFUICKCT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.87 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|