C5H3Cl3F6 — CID 168864628
2,2,4-trichloro-1,1,1,5,5,5-hexafluoropentane (PubChem CID 168864628) has the molecular formula C5H3Cl3F6 and a molecular weight of 283.43 g/mol. Its IUPAC name is 2,2,4-trichloro-1,1,1,5,5,5-hexafluoropentane.
| Compound Name | 2,2,4-trichloro-1,1,1,5,5,5-hexafluoropentane |
|---|---|
| PubChem CID | 168864628 |
| Molecular Formula | C5H3Cl3F6 |
| Molecular Weight | 283.43 g/mol |
| Exact Mass | 281.92 |
| IUPAC Name | 2,2,4-trichloro-1,1,1,5,5,5-hexafluoropentane |
| SMILES | FC(F)(F)C(Cl)CC(Cl)(Cl)C(F)(F)F |
| InChI | InChI=1S/C5H3Cl3F6/c6-2(4(9,10)11)1-3(7,8)5(12,13)14/h2H,1H2 |
| InChIKey | JIPSYLSNJHLZAH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|