C12H16Cl3F5O2 — CID 13020518
ethyl 4,6,6-trichloro-7,7,8,8,8-pentafluoro-3,3-dimethyloctanoate (PubChem CID 13020518) has the molecular formula C12H16Cl3F5O2 and a molecular weight of 393.61 g/mol. Its IUPAC name is ethyl 4,6,6-trichloro-7,7,8,8,8-pentafluoro-3,3-dimethyloctanoate.
| Compound Name | ethyl 4,6,6-trichloro-7,7,8,8,8-pentafluoro-3,3-dimethyloctanoate |
|---|---|
| PubChem CID | 13020518 |
| Molecular Formula | C12H16Cl3F5O2 |
| Molecular Weight | 393.61 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | ethyl 4,6,6-trichloro-7,7,8,8,8-pentafluoro-3,3-dimethyloctanoate |
| SMILES | CCOC(=O)CC(C)(C)C(Cl)CC(Cl)(Cl)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H16Cl3F5O2/c1-4-22-8(21)6-9(2,3)7(13)5-10(14,15)11(16,17)12(18,19)20/h7H,4-6H2,1-3H3 |
| InChIKey | GVLUJJPLJUWHIM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.61 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|