C15H14Cl4F4O2 — CID 19786048
(2,3,5,6-tetrafluorophenyl)methyl 4,6,6,6-tetrachloro-3,3-dimethylhexanoate (PubChem CID 19786048) has the molecular formula C15H14Cl4F4O2 and a molecular weight of 444.08 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl)methyl 4,6,6,6-tetrachloro-3,3-dimethylhexanoate.
| Compound Name | (2,3,5,6-tetrafluorophenyl)methyl 4,6,6,6-tetrachloro-3,3-dimethylhexanoate |
|---|---|
| PubChem CID | 19786048 |
| Molecular Formula | C15H14Cl4F4O2 |
| Molecular Weight | 444.08 g/mol |
| Exact Mass | 441.97 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl)methyl 4,6,6,6-tetrachloro-3,3-dimethylhexanoate |
| SMILES | CC(C)(CC(=O)OCc1c(F)c(F)cc(F)c1F)C(Cl)CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H14Cl4F4O2/c1-14(2,10(16)4-15(17,18)19)5-11(24)25-6-7-12(22)8(20)3-9(21)13(7)23/h3,10H,4-6H2,1-2H3 |
| InChIKey | WSJNHQKLBYYLMM-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.08 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|