C19H21F4NO3S — CID 89307538
[2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl 6-cyano-3,3,4-trimethyl-6-sulfanylhex-5-enoate (PubChem CID 89307538) has the molecular formula C19H21F4NO3S and a molecular weight of 419.44 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl 6-cyano-3,3,4-trimethyl-6-sulfanylhex-5-enoate.
| Compound Name | [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl 6-cyano-3,3,4-trimethyl-6-sulfanylhex-5-enoate |
|---|---|
| PubChem CID | 89307538 |
| Molecular Formula | C19H21F4NO3S |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl 6-cyano-3,3,4-trimethyl-6-sulfanylhex-5-enoate |
| SMILES | COCc1c(F)c(F)c(COC(=O)CC(C)(C)C(C)C=C(S)C#N)c(F)c1F |
| InChI | InChI=1S/C19H21F4NO3S/c1-10(5-11(28)7-24)19(2,3)6-14(25)27-9-13-17(22)15(20)12(8-26-4)16(21)18(13)23/h5,10,28H,6,8-9H2,1-4H3 |
| InChIKey | XECOBTWVHAAUFB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 59.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|