C20H18Cl2F4O3 — CID 141338322
[2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl (3S)-3-(3,4-dichlorophenyl)pentanoate (PubChem CID 141338322) has the molecular formula C20H18Cl2F4O3 and a molecular weight of 453.26 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl (3S)-3-(3,4-dichlorophenyl)pentanoate.
| Compound Name | [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl (3S)-3-(3,4-dichlorophenyl)pentanoate |
|---|---|
| PubChem CID | 141338322 |
| Molecular Formula | C20H18Cl2F4O3 |
| Molecular Weight | 453.26 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl (3S)-3-(3,4-dichlorophenyl)pentanoate |
| SMILES | CC[C@@H](CC(=O)OCc1c(F)c(F)c(COC)c(F)c1F)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H18Cl2F4O3/c1-3-10(11-4-5-14(21)15(22)6-11)7-16(27)29-9-13-19(25)17(23)12(8-28-2)18(24)20(13)26/h4-6,10H,3,7-9H2,1-2H3/t10-/m0/s1 |
| InChIKey | SOPXYNTYNPZYIF-JTQLQIEISA-N |
| XLogP | 6.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.26 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|