C14H20Cl2N2O — CID 82139155
4-amino-3-(3,4-dichlorophenyl)-N,N-diethylbutanamide (PubChem CID 82139155) has the molecular formula C14H20Cl2N2O and a molecular weight of 303.23 g/mol. Its IUPAC name is 4-amino-3-(3,4-dichlorophenyl)-N,N-diethylbutanamide.
| Compound Name | 4-amino-3-(3,4-dichlorophenyl)-N,N-diethylbutanamide |
|---|---|
| PubChem CID | 82139155 |
| Molecular Formula | C14H20Cl2N2O |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 4-amino-3-(3,4-dichlorophenyl)-N,N-diethylbutanamide |
| SMILES | CCN(CC)C(=O)CC(CN)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H20Cl2N2O/c1-3-18(4-2)14(19)8-11(9-17)10-5-6-12(15)13(16)7-10/h5-7,11H,3-4,8-9,17H2,1-2H3 |
| InChIKey | QPRXLKHPUSZZQE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |