C13H15Cl2NO3 — CID 57063992
3-(3,4-dichlorophenyl)-N-methoxy-N-methyl-5-oxopentanamide (PubChem CID 57063992) has the molecular formula C13H15Cl2NO3 and a molecular weight of 304.17 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-methoxy-N-methyl-5-oxopentanamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-methoxy-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 57063992 |
| Molecular Formula | C13H15Cl2NO3 |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-methoxy-N-methyl-5-oxopentanamide |
| SMILES | CON(C)C(=O)CC(CC=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2NO3/c1-16(19-2)13(18)8-10(5-6-17)9-3-4-11(14)12(15)7-9/h3-4,6-7,10H,5,8H2,1-2H3 |
| InChIKey | UYZAAVVHMQGSTH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|