C24H25Cl4NO4 — CID 159060521
(2R)-2-(3,4-dichlorophenyl)-N-methoxy-N-methylpent-4-enamide;(2R)-2-(3,4-dichlorophenyl)pent-4-enoic acid (PubChem CID 159060521) has the molecular formula C24H25Cl4NO4 and a molecular weight of 533.28 g/mol. Its IUPAC name is (2R)-2-(3,4-dichlorophenyl)-N-methoxy-N-methylpent-4-enamide;(2R)-2-(3,4-dichlorophenyl)pent-4-enoic acid.
| Compound Name | (2R)-2-(3,4-dichlorophenyl)-N-methoxy-N-methylpent-4-enamide;(2R)-2-(3,4-dichlorophenyl)pent-4-enoic acid |
|---|---|
| PubChem CID | 159060521 |
| Molecular Formula | C24H25Cl4NO4 |
| Molecular Weight | 533.28 g/mol |
| Exact Mass | 531.05 |
| IUPAC Name | (2R)-2-(3,4-dichlorophenyl)-N-methoxy-N-methylpent-4-enamide;(2R)-2-(3,4-dichlorophenyl)pent-4-enoic acid |
| SMILES | C=CC[C@@H](C(=O)N(C)OC)c1ccc(Cl)c(Cl)c1.C=CC[C@@H](C(=O)O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2NO2.C11H10Cl2O2/c1-4-5-10(13(17)16(2)18-3)9-6-7-11(14)12(15)8-9;1-2-3-8(11(14)15)7-4-5-9(12)10(13)6-7/h4,6-8,10H,1,5H2,2-3H3;2,4-6,8H,1,3H2,(H,14,15)/t10-;8-/m11/s1 |
| InChIKey | JYKFSCZXTAYRIS-HXIVXZATSA-N |
| XLogP | 7.41 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.28 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|