C17H16Cl2O3 — CID 83955360
3-(3,4-dichlorophenyl)-2-(4-methoxy-3-methylphenyl)propanoic acid (PubChem CID 83955360) has the molecular formula C17H16Cl2O3 and a molecular weight of 339.22 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-2-(4-methoxy-3-methylphenyl)propanoic acid.
| Compound Name | 3-(3,4-dichlorophenyl)-2-(4-methoxy-3-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 83955360 |
| Molecular Formula | C17H16Cl2O3 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-2-(4-methoxy-3-methylphenyl)propanoic acid |
| SMILES | COc1ccc(C(Cc2ccc(Cl)c(Cl)c2)C(=O)O)cc1C |
| InChI | InChI=1S/C17H16Cl2O3/c1-10-7-12(4-6-16(10)22-2)13(17(20)21)8-11-3-5-14(18)15(19)9-11/h3-7,9,13H,8H2,1-2H3,(H,20,21) |
| InChIKey | ZGLJRJGOTGKOQV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |