C18H18O5 — CID 83955750
4-[2-carboxy-2-(4-methoxy-3-methylphenyl)ethyl]benzoic acid (PubChem CID 83955750) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is 4-[2-carboxy-2-(4-methoxy-3-methylphenyl)ethyl]benzoic acid.
| Compound Name | 4-[2-carboxy-2-(4-methoxy-3-methylphenyl)ethyl]benzoic acid |
|---|---|
| PubChem CID | 83955750 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 4-[2-carboxy-2-(4-methoxy-3-methylphenyl)ethyl]benzoic acid |
| SMILES | COc1ccc(C(Cc2ccc(C(=O)O)cc2)C(=O)O)cc1C |
| InChI | InChI=1S/C18H18O5/c1-11-9-14(7-8-16(11)23-2)15(18(21)22)10-12-3-5-13(6-4-12)17(19)20/h3-9,15H,10H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | OQAIMCOHILXVBV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |