C21H23Cl2NO3 — CID 22137542
[4-[benzoyl(ethyl)amino]-3-(3,4-dichlorophenyl)butyl] acetate (PubChem CID 22137542) has the molecular formula C21H23Cl2NO3 and a molecular weight of 408.33 g/mol. Its IUPAC name is [4-[benzoyl(ethyl)amino]-3-(3,4-dichlorophenyl)butyl] acetate.
| Compound Name | [4-[benzoyl(ethyl)amino]-3-(3,4-dichlorophenyl)butyl] acetate |
|---|---|
| PubChem CID | 22137542 |
| Molecular Formula | C21H23Cl2NO3 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | [4-[benzoyl(ethyl)amino]-3-(3,4-dichlorophenyl)butyl] acetate |
| SMILES | CCN(CC(CCOC(C)=O)c1ccc(Cl)c(Cl)c1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H23Cl2NO3/c1-3-24(21(26)16-7-5-4-6-8-16)14-18(11-12-27-15(2)25)17-9-10-19(22)20(23)13-17/h4-10,13,18H,3,11-12,14H2,1-2H3 |
| InChIKey | GWXMEVAIOXCWEE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |