C15H14Cl2F4O2 — CID 89033301
(2,3,5,6-tetrafluorophenyl)methyl (3R)-5,5-dichloro-3-propan-2-ylpent-4-enoate (PubChem CID 89033301) has the molecular formula C15H14Cl2F4O2 and a molecular weight of 373.17 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl)methyl (3R)-5,5-dichloro-3-propan-2-ylpent-4-enoate.
| Compound Name | (2,3,5,6-tetrafluorophenyl)methyl (3R)-5,5-dichloro-3-propan-2-ylpent-4-enoate |
|---|---|
| PubChem CID | 89033301 |
| Molecular Formula | C15H14Cl2F4O2 |
| Molecular Weight | 373.17 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl)methyl (3R)-5,5-dichloro-3-propan-2-ylpent-4-enoate |
| SMILES | CC(C)C(C=C(Cl)Cl)CC(=O)OCc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C15H14Cl2F4O2/c1-7(2)8(3-12(16)17)4-13(22)23-6-9-14(20)10(18)5-11(19)15(9)21/h3,5,7-8H,4,6H2,1-2H3 |
| InChIKey | KVAVWXJHUDOPMT-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.17 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|