C23H30Cl2F4NO6PS2 — CID 87446171
cis-(2,3,5,6-tetrafluorophenyl)methyl (1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate;2-(2-dimethoxyphosphorylsulfanylethylsulfanyl)-N-methylpropanamide (PubChem CID 87446171) has the molecular formula C23H30Cl2F4NO6PS2 and a molecular weight of 658.50 g/mol. Its IUPAC name is cis-(2,3,5,6-tetrafluorophenyl)methyl (1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate;2-(2-dimethoxyphosphorylsulfanylethylsulfanyl)-N-methylpropanamide.
| Compound Name | cis-(2,3,5,6-tetrafluorophenyl)methyl (1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate;2-(2-dimethoxyphosphorylsulfanylethylsulfanyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 87446171 |
| Molecular Formula | C23H30Cl2F4NO6PS2 |
| Molecular Weight | 658.50 g/mol |
| Exact Mass | 657.06 |
| IUPAC Name | cis-(2,3,5,6-tetrafluorophenyl)methyl (1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate;2-(2-dimethoxyphosphorylsulfanylethylsulfanyl)-N-methylpropanamide |
| SMILES | CC1(C)[C@H](C=C(Cl)Cl)[C@H]1C(=O)OCc1c(F)c(F)cc(F)c1F.CNC(=O)C(C)SCCSP(=O)(OC)OC |
| InChI | InChI=1S/C15H12Cl2F4O2.C8H18NO4PS2/c1-15(2)7(3-10(16)17)11(15)14(22)23-5-6-12(20)8(18)4-9(19)13(6)21;1-7(8(10)9-2)15-5-6-16-14(11,12-3)13-4/h3-4,7,11H,5H2,1-2H3;7H,5-6H2,1-4H3,(H,9,10)/t7-,11+;/m1./s1 |
| InChIKey | YWBZLFXBVAUZHN-YERNIVPCSA-N |
| XLogP | 6.87 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.50 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|