C18H19F3O4 — CID 145410753
(2,3,5-trifluoro-6-methylphenyl)methyl 3-(3-methoxy-3-oxoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 145410753) has the molecular formula C18H19F3O4 and a molecular weight of 356.34 g/mol. Its IUPAC name is (2,3,5-trifluoro-6-methylphenyl)methyl 3-(3-methoxy-3-oxoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | (2,3,5-trifluoro-6-methylphenyl)methyl 3-(3-methoxy-3-oxoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 145410753 |
| Molecular Formula | C18H19F3O4 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (2,3,5-trifluoro-6-methylphenyl)methyl 3-(3-methoxy-3-oxoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | COC(=O)C=CC1C(C(=O)OCc2c(C)c(F)cc(F)c2F)C1(C)C |
| InChI | InChI=1S/C18H19F3O4/c1-9-10(16(21)13(20)7-12(9)19)8-25-17(23)15-11(18(15,2)3)5-6-14(22)24-4/h5-7,11,15H,8H2,1-4H3 |
| InChIKey | DWLLCXWENUUMLK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|