C18H21F3O3 — CID 146551864
[2,3,6-trifluoro-4-(methoxymethyl)phenyl]methyl 2,2-dimethyl-3-[(Z)-prop-1-enyl]cyclopropane-1-carboxylate (PubChem CID 146551864) has the molecular formula C18H21F3O3 and a molecular weight of 342.36 g/mol. Its IUPAC name is [2,3,6-trifluoro-4-(methoxymethyl)phenyl]methyl 2,2-dimethyl-3-[(Z)-prop-1-enyl]cyclopropane-1-carboxylate.
| Compound Name | [2,3,6-trifluoro-4-(methoxymethyl)phenyl]methyl 2,2-dimethyl-3-[(Z)-prop-1-enyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 146551864 |
| Molecular Formula | C18H21F3O3 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | [2,3,6-trifluoro-4-(methoxymethyl)phenyl]methyl 2,2-dimethyl-3-[(Z)-prop-1-enyl]cyclopropane-1-carboxylate |
| SMILES | C/C=C\C1C(C(=O)OCc2c(F)cc(COC)c(F)c2F)C1(C)C |
| InChI | InChI=1S/C18H21F3O3/c1-5-6-12-14(18(12,2)3)17(22)24-9-11-13(19)7-10(8-23-4)15(20)16(11)21/h5-7,12,14H,8-9H2,1-4H3/b6-5- |
| InChIKey | BAXDHLJUABRZFE-WAYWQWQTSA-N |
| XLogP | 4.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|