C18H21F3O2 — CID 150978175
cis-(2-ethyl-3,5,6-trifluorophenyl)methyl (1R,3R)-2,2-dimethyl-3-[(Z)-prop-1-enyl]cyclopropane-1-carboxylate (PubChem CID 150978175) has the molecular formula C18H21F3O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is cis-(2-ethyl-3,5,6-trifluorophenyl)methyl (1R,3R)-2,2-dimethyl-3-[(Z)-prop-1-enyl]cyclopropane-1-carboxylate.
| Compound Name | cis-(2-ethyl-3,5,6-trifluorophenyl)methyl (1R,3R)-2,2-dimethyl-3-[(Z)-prop-1-enyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 150978175 |
| Molecular Formula | C18H21F3O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | cis-(2-ethyl-3,5,6-trifluorophenyl)methyl (1R,3R)-2,2-dimethyl-3-[(Z)-prop-1-enyl]cyclopropane-1-carboxylate |
| SMILES | C/C=C\[C@@H]1[C@@H](C(=O)OCc2c(F)c(F)cc(F)c2CC)C1(C)C |
| InChI | InChI=1S/C18H21F3O2/c1-5-7-12-15(18(12,3)4)17(22)23-9-11-10(6-2)13(19)8-14(20)16(11)21/h5,7-8,12,15H,6,9H2,1-4H3/b7-5-/t12-,15+/m1/s1 |
| InChIKey | LPNLUUQKJBEJTA-BRDDXIKOSA-N |
| XLogP | 4.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|