C18H18ClF5O2 — CID 151885557
trans-(3,5-difluoro-2,6-dimethylphenyl)methyl (1R,3R)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 151885557) has the molecular formula C18H18ClF5O2 and a molecular weight of 396.78 g/mol. Its IUPAC name is trans-(3,5-difluoro-2,6-dimethylphenyl)methyl (1R,3R)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | trans-(3,5-difluoro-2,6-dimethylphenyl)methyl (1R,3R)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 151885557 |
| Molecular Formula | C18H18ClF5O2 |
| Molecular Weight | 396.78 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | trans-(3,5-difluoro-2,6-dimethylphenyl)methyl (1R,3R)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | Cc1c(F)cc(F)c(C)c1COC(=O)[C@@H]1[C@H](/C=C(\Cl)C(F)(F)F)C1(C)C |
| InChI | InChI=1S/C18H18ClF5O2/c1-8-10(9(2)13(21)6-12(8)20)7-26-16(25)15-11(17(15,3)4)5-14(19)18(22,23)24/h5-6,11,15H,7H2,1-4H3/b14-5-/t11-,15-/m0/s1 |
| InChIKey | SPQABIFDWIXSCK-ARFUEELQSA-N |
| XLogP | 5.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.78 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |