C16H12Br2ClF5O2 — CID 151362290
trans-(2,6-dibromo-3,5-difluorophenyl)methyl (1S,3S)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 151362290) has the molecular formula C16H12Br2ClF5O2 and a molecular weight of 526.52 g/mol. Its IUPAC name is trans-(2,6-dibromo-3,5-difluorophenyl)methyl (1S,3S)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | trans-(2,6-dibromo-3,5-difluorophenyl)methyl (1S,3S)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 151362290 |
| Molecular Formula | C16H12Br2ClF5O2 |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 523.88 |
| IUPAC Name | trans-(2,6-dibromo-3,5-difluorophenyl)methyl (1S,3S)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)[C@H](/C=C(\Cl)C(F)(F)F)[C@@H]1C(=O)OCc1c(Br)c(F)cc(F)c1Br |
| InChI | InChI=1S/C16H12Br2ClF5O2/c1-15(2)7(3-10(19)16(22,23)24)11(15)14(25)26-5-6-12(17)8(20)4-9(21)13(6)18/h3-4,7,11H,5H2,1-2H3/b10-3-/t7-,11-/m1/s1 |
| InChIKey | OOSLBNUJRITICY-KOSBVFGVSA-N |
| XLogP | 6.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|