C18H17ClF6O2 — CID 150576283
trans-(2-ethyl-3,5,6-trifluorophenyl)methyl (1R,3R)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 150576283) has the molecular formula C18H17ClF6O2 and a molecular weight of 414.77 g/mol. Its IUPAC name is trans-(2-ethyl-3,5,6-trifluorophenyl)methyl (1R,3R)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | trans-(2-ethyl-3,5,6-trifluorophenyl)methyl (1R,3R)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 150576283 |
| Molecular Formula | C18H17ClF6O2 |
| Molecular Weight | 414.77 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | trans-(2-ethyl-3,5,6-trifluorophenyl)methyl (1R,3R)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CCc1c(F)cc(F)c(F)c1COC(=O)[C@@H]1[C@H](/C=C(\Cl)C(F)(F)F)C1(C)C |
| InChI | InChI=1S/C18H17ClF6O2/c1-4-8-9(15(22)12(21)6-11(8)20)7-27-16(26)14-10(17(14,2)3)5-13(19)18(23,24)25/h5-6,10,14H,4,7H2,1-3H3/b13-5-/t10-,14-/m0/s1 |
| InChIKey | IMWQCAXZNIXMPN-FWBGNYOCSA-N |
| XLogP | 5.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.77 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|