C17H16F4O4 — CID 87195603
(E)-4-[2,2-dimethyl-3-[(2,3,5,6-tetrafluorophenyl)methoxycarbonyl]cyclopropyl]but-3-enoic acid (PubChem CID 87195603) has the molecular formula C17H16F4O4 and a molecular weight of 360.30 g/mol. Its IUPAC name is (E)-4-[2,2-dimethyl-3-[(2,3,5,6-tetrafluorophenyl)methoxycarbonyl]cyclopropyl]but-3-enoic acid.
| Compound Name | (E)-4-[2,2-dimethyl-3-[(2,3,5,6-tetrafluorophenyl)methoxycarbonyl]cyclopropyl]but-3-enoic acid |
|---|---|
| PubChem CID | 87195603 |
| Molecular Formula | C17H16F4O4 |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (E)-4-[2,2-dimethyl-3-[(2,3,5,6-tetrafluorophenyl)methoxycarbonyl]cyclopropyl]but-3-enoic acid |
| SMILES | CC1(C)C(/C=C/CC(=O)O)C1C(=O)OCc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C17H16F4O4/c1-17(2)9(4-3-5-12(22)23)13(17)16(24)25-7-8-14(20)10(18)6-11(19)15(8)21/h3-4,6,9,13H,5,7H2,1-2H3,(H,22,23)/b4-3+ |
| InChIKey | RQGJEPVPDNRATQ-ONEGZZNKSA-N |
| XLogP | 3.59 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|