C10H8ClF3O2 — CID 117384557
3-(3-chloro-2,5,6-trifluorophenyl)-2-methylpropanoic acid (PubChem CID 117384557) has the molecular formula C10H8ClF3O2 and a molecular weight of 252.62 g/mol. Its IUPAC name is 3-(3-chloro-2,5,6-trifluorophenyl)-2-methylpropanoic acid.
| Compound Name | 3-(3-chloro-2,5,6-trifluorophenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 117384557 |
| Molecular Formula | C10H8ClF3O2 |
| Molecular Weight | 252.62 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 3-(3-chloro-2,5,6-trifluorophenyl)-2-methylpropanoic acid |
| SMILES | CC(Cc1c(F)c(F)cc(Cl)c1F)C(=O)O |
| InChI | InChI=1S/C10H8ClF3O2/c1-4(10(15)16)2-5-8(13)6(11)3-7(12)9(5)14/h3-4H,2H2,1H3,(H,15,16) |
| InChIKey | PUYFYKWQMUMYQM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.62 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|