C14H22F3NO5 — CID 177238564
ethyl 4-[(3-ethoxy-3-oxopropanoyl)amino]-5,5,5-trifluoro-3,3-dimethylpentanoate (PubChem CID 177238564) has the molecular formula C14H22F3NO5 and a molecular weight of 341.33 g/mol. Its IUPAC name is ethyl 4-[(3-ethoxy-3-oxopropanoyl)amino]-5,5,5-trifluoro-3,3-dimethylpentanoate.
| Compound Name | ethyl 4-[(3-ethoxy-3-oxopropanoyl)amino]-5,5,5-trifluoro-3,3-dimethylpentanoate |
|---|---|
| PubChem CID | 177238564 |
| Molecular Formula | C14H22F3NO5 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | ethyl 4-[(3-ethoxy-3-oxopropanoyl)amino]-5,5,5-trifluoro-3,3-dimethylpentanoate |
| SMILES | CCOC(=O)CC(=O)NC(C(F)(F)F)C(C)(C)CC(=O)OCC |
| InChI | InChI=1S/C14H22F3NO5/c1-5-22-10(20)7-9(19)18-12(14(15,16)17)13(3,4)8-11(21)23-6-2/h12H,5-8H2,1-4H3,(H,18,19) |
| InChIKey | IUKSLWPQRNNGHE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|