C11H16F3NO5 — CID 88504083
3-[(3-ethoxy-3-oxopropanoyl)amino]-4,4,4-trifluoro-2,3-dimethylbutanoic acid (PubChem CID 88504083) has the molecular formula C11H16F3NO5 and a molecular weight of 299.25 g/mol. Its IUPAC name is 3-[(3-ethoxy-3-oxopropanoyl)amino]-4,4,4-trifluoro-2,3-dimethylbutanoic acid.
| Compound Name | 3-[(3-ethoxy-3-oxopropanoyl)amino]-4,4,4-trifluoro-2,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 88504083 |
| Molecular Formula | C11H16F3NO5 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 3-[(3-ethoxy-3-oxopropanoyl)amino]-4,4,4-trifluoro-2,3-dimethylbutanoic acid |
| SMILES | CCOC(=O)CC(=O)NC(C)(C(C)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C11H16F3NO5/c1-4-20-8(17)5-7(16)15-10(3,11(12,13)14)6(2)9(18)19/h6H,4-5H2,1-3H3,(H,15,16)(H,18,19) |
| InChIKey | RYDYSBKVZSIIHL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|