C14H20F3NO5 — CID 177239337
ethyl 4-[(3-ethoxy-3-oxopropanoyl)amino]-5,5,5-trifluoro-2,3-dimethylpent-2-enoate (PubChem CID 177239337) has the molecular formula C14H20F3NO5 and a molecular weight of 339.31 g/mol. Its IUPAC name is ethyl 4-[(3-ethoxy-3-oxopropanoyl)amino]-5,5,5-trifluoro-2,3-dimethylpent-2-enoate.
| Compound Name | ethyl 4-[(3-ethoxy-3-oxopropanoyl)amino]-5,5,5-trifluoro-2,3-dimethylpent-2-enoate |
|---|---|
| PubChem CID | 177239337 |
| Molecular Formula | C14H20F3NO5 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | ethyl 4-[(3-ethoxy-3-oxopropanoyl)amino]-5,5,5-trifluoro-2,3-dimethylpent-2-enoate |
| SMILES | CCOC(=O)CC(=O)NC(C(C)=C(C)C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C14H20F3NO5/c1-5-22-11(20)7-10(19)18-12(14(15,16)17)8(3)9(4)13(21)23-6-2/h12H,5-7H2,1-4H3,(H,18,19) |
| InChIKey | YSYXYDHZLCEFRF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|