C7H11F3N2O3 — CID 40557744
ethyl (2R)-3,3,3-trifluoro-2-(methylcarbamoylamino)propanoate (PubChem CID 40557744) has the molecular formula C7H11F3N2O3 and a molecular weight of 228.17 g/mol. Its IUPAC name is ethyl (2R)-3,3,3-trifluoro-2-(methylcarbamoylamino)propanoate.
| Compound Name | ethyl (2R)-3,3,3-trifluoro-2-(methylcarbamoylamino)propanoate |
|---|---|
| PubChem CID | 40557744 |
| Molecular Formula | C7H11F3N2O3 |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | ethyl (2R)-3,3,3-trifluoro-2-(methylcarbamoylamino)propanoate |
| SMILES | CCOC(=O)[C@@H](NC(=O)NC)C(F)(F)F |
| InChI | InChI=1S/C7H11F3N2O3/c1-3-15-5(13)4(7(8,9)10)12-6(14)11-2/h4H,3H2,1-2H3,(H2,11,12,14)/t4-/m1/s1 |
| InChIKey | CLDZFECQJYEHBN-SCSAIBSYSA-N |
| XLogP | 0.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |