C12H18Cl3F3O2 — CID 151795135
ethyl 5,7,7-trichloro-8,8,8-trifluoro-4,4-dimethyloctanoate (PubChem CID 151795135) has the molecular formula C12H18Cl3F3O2 and a molecular weight of 357.63 g/mol. Its IUPAC name is ethyl 5,7,7-trichloro-8,8,8-trifluoro-4,4-dimethyloctanoate.
| Compound Name | ethyl 5,7,7-trichloro-8,8,8-trifluoro-4,4-dimethyloctanoate |
|---|---|
| PubChem CID | 151795135 |
| Molecular Formula | C12H18Cl3F3O2 |
| Molecular Weight | 357.63 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | ethyl 5,7,7-trichloro-8,8,8-trifluoro-4,4-dimethyloctanoate |
| SMILES | CCOC(=O)CCC(C)(C)C(Cl)CC(Cl)(Cl)C(F)(F)F |
| InChI | InChI=1S/C12H18Cl3F3O2/c1-4-20-9(19)5-6-10(2,3)8(13)7-11(14,15)12(16,17)18/h8H,4-7H2,1-3H3 |
| InChIKey | RXLDFZHFGHJPOT-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.63 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|