C6H3Cl3F8 — CID 177190739
3,5,5-trichloro-1,1,1,2,2,6,6,6-octafluorohexane (PubChem CID 177190739) has the molecular formula C6H3Cl3F8 and a molecular weight of 333.43 g/mol. Its IUPAC name is 3,5,5-trichloro-1,1,1,2,2,6,6,6-octafluorohexane.
| Compound Name | 3,5,5-trichloro-1,1,1,2,2,6,6,6-octafluorohexane |
|---|---|
| PubChem CID | 177190739 |
| Molecular Formula | C6H3Cl3F8 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 331.92 |
| IUPAC Name | 3,5,5-trichloro-1,1,1,2,2,6,6,6-octafluorohexane |
| SMILES | FC(F)(F)C(Cl)(Cl)CC(Cl)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H3Cl3F8/c7-2(4(10,11)6(15,16)17)1-3(8,9)5(12,13)14/h2H,1H2 |
| InChIKey | FSIQBGJJTCVVJU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|